C12H15BrF3N — CID 107082268
4-(bromomethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 107082268) has the molecular formula C12H15BrF3N and a molecular weight of 310.16 g/mol. Its IUPAC name is 4-(bromomethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-(bromomethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 107082268 |
| Molecular Formula | C12H15BrF3N |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 4-(bromomethyl)-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CC(C)N(CC(F)(F)F)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C12H15BrF3N/c1-9(2)17(8-12(14,15)16)11-5-3-10(7-13)4-6-11/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | AHIHFOCKCSPMRM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|