About tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate (PubChem CID 10708275) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate.
Molecular Properties
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate |
| PubChem CID | 10708275 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate |
| SMILES | C=CCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-8-9-10-11(12(17)19-14(2,3)4)16-13(18)20-15(5,6)7/h8,11H,1,9-10H2,2-7H3,(H,16,18) |
| InChIKey | HCCCYDLUFISNCU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate?
The IUPAC name of tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate (CID 10708275) is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate.
What is the SMILES notation for tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate?
The canonical SMILES for tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate is C=CCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate?
The InChIKey is HCCCYDLUFISNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4/c1-8-9-10-11(12(17)19-14(2,3)4)16-13(18)20-15(5,6)7/h8,11H,1,9-10H2,2-7H3,(H,16,18).
What are the key properties of tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate?
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate has a molecular weight of 285.38 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate is sourced from PubChem (CID 10708275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).