C17H19BrClN — CID 107083095
4-(bromomethyl)-N-[1-(3-chlorophenyl)ethyl]-N,3-dimethylaniline (PubChem CID 107083095) has the molecular formula C17H19BrClN and a molecular weight of 352.70 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[1-(3-chlorophenyl)ethyl]-N,3-dimethylaniline.
| Compound Name | 4-(bromomethyl)-N-[1-(3-chlorophenyl)ethyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 107083095 |
| Molecular Formula | C17H19BrClN |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 4-(bromomethyl)-N-[1-(3-chlorophenyl)ethyl]-N,3-dimethylaniline |
| SMILES | Cc1cc(N(C)C(C)c2cccc(Cl)c2)ccc1CBr |
| InChI | InChI=1S/C17H19BrClN/c1-12-9-17(8-7-15(12)11-18)20(3)13(2)14-5-4-6-16(19)10-14/h4-10,13H,11H2,1-3H3 |
| InChIKey | IUMLYGRUQLHZFJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|