C16H18BrN3 — CID 107083734
1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-methyl-2,3-dihydroquinoxaline (PubChem CID 107083734) has the molecular formula C16H18BrN3 and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-methyl-2,3-dihydroquinoxaline.
| Compound Name | 1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-methyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 107083734 |
| Molecular Formula | C16H18BrN3 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-methyl-2,3-dihydroquinoxaline |
| SMILES | Cc1cc(CBr)cnc1N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C16H18BrN3/c1-12-9-13(10-17)11-18-16(12)20-8-7-19(2)14-5-3-4-6-15(14)20/h3-6,9,11H,7-8,10H2,1-2H3 |
| InChIKey | IDFNUUBVYPPZNJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|