C12H15ClN2O4 — CID 10708384
methyl (2R,3S)-3-chloro-2-(2,5-dioxopyrrolidin-1-yl)-1-methyl-3,4-dihydro-2H-pyridine-5-carboxylate (PubChem CID 10708384) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is methyl (2R,3S)-3-chloro-2-(2,5-dioxopyrrolidin-1-yl)-1-methyl-3,4-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2R,3S)-3-chloro-2-(2,5-dioxopyrrolidin-1-yl)-1-methyl-3,4-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 10708384 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | methyl (2R,3S)-3-chloro-2-(2,5-dioxopyrrolidin-1-yl)-1-methyl-3,4-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CN(C)[C@H](N2C(=O)CCC2=O)[C@@H](Cl)C1 |
| InChI | InChI=1S/C12H15ClN2O4/c1-14-6-7(12(18)19-2)5-8(13)11(14)15-9(16)3-4-10(15)17/h6,8,11H,3-5H2,1-2H3/t8-,11+/m0/s1 |
| InChIKey | VLWHPUYXADKVIE-GZMMTYOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|