C15H20BrN3 — CID 107083876
3-(bromomethyl)-2-(3,3-dimethylpiperidin-1-yl)imidazo[1,2-a]pyridine (PubChem CID 107083876) has the molecular formula C15H20BrN3 and a molecular weight of 322.25 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(3,3-dimethylpiperidin-1-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(bromomethyl)-2-(3,3-dimethylpiperidin-1-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 107083876 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(bromomethyl)-2-(3,3-dimethylpiperidin-1-yl)imidazo[1,2-a]pyridine |
| SMILES | CC1(C)CCCN(c2nc3ccccn3c2CBr)C1 |
| InChI | InChI=1S/C15H20BrN3/c1-15(2)7-5-8-18(11-15)14-12(10-16)19-9-4-3-6-13(19)17-14/h3-4,6,9H,5,7-8,10-11H2,1-2H3 |
| InChIKey | UWUHJETZXLVIKS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|