C14H20BrNO — CID 107084059
1-[4-(bromomethyl)-2-methylphenyl]-3-(methoxymethyl)pyrrolidine (PubChem CID 107084059) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-methylphenyl]-3-(methoxymethyl)pyrrolidine.
| Compound Name | 1-[4-(bromomethyl)-2-methylphenyl]-3-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 107084059 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-[4-(bromomethyl)-2-methylphenyl]-3-(methoxymethyl)pyrrolidine |
| SMILES | COCC1CCN(c2ccc(CBr)cc2C)C1 |
| InChI | InChI=1S/C14H20BrNO/c1-11-7-12(8-15)3-4-14(11)16-6-5-13(9-16)10-17-2/h3-4,7,13H,5-6,8-10H2,1-2H3 |
| InChIKey | OSWMIQZSRRWAQT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|