About 3,4-dichloro-2,5-diphenyl-1H-pyrrole
3,4-dichloro-2,5-diphenyl-1H-pyrrole (PubChem CID 10708464) has the molecular formula C16H11Cl2N
and a molecular weight of 288.18 g/mol. Its IUPAC name is 3,4-dichloro-2,5-diphenyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3,4-dichloro-2,5-diphenyl-1H-pyrrole |
| PubChem CID | 10708464 |
| Molecular Formula | C16H11Cl2N |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3,4-dichloro-2,5-diphenyl-1H-pyrrole |
| SMILES | Clc1c(-c2ccccc2)[nH]c(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C16H11Cl2N/c17-13-14(18)16(12-9-5-2-6-10-12)19-15(13)11-7-3-1-4-8-11/h1-10,19H |
| InChIKey | AANPMABCJQGXQJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,4-dichloro-2,5-diphenyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-2,5-diphenyl-1H-pyrrole?
The IUPAC name of 3,4-dichloro-2,5-diphenyl-1H-pyrrole (CID 10708464) is 3,4-dichloro-2,5-diphenyl-1H-pyrrole.
What is the SMILES notation for 3,4-dichloro-2,5-diphenyl-1H-pyrrole?
The canonical SMILES for 3,4-dichloro-2,5-diphenyl-1H-pyrrole is Clc1c(-c2ccccc2)[nH]c(-c2ccccc2)c1Cl.
What is the InChIKey of 3,4-dichloro-2,5-diphenyl-1H-pyrrole?
The InChIKey is AANPMABCJQGXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N/c17-13-14(18)16(12-9-5-2-6-10-12)19-15(13)11-7-3-1-4-8-11/h1-10,19H.
What are the key properties of 3,4-dichloro-2,5-diphenyl-1H-pyrrole?
3,4-dichloro-2,5-diphenyl-1H-pyrrole has a molecular weight of 288.18 g/mol, XLogP of 5.66, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-2,5-diphenyl-1H-pyrrole is sourced from PubChem (CID 10708464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).