About 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea
1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea (PubChem CID 10708495) has the molecular formula C14H20N6O
and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea |
| PubChem CID | 10708495 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C14H20N6O/c1-8(2)10-6-5-7-11(9(3)4)12(10)15-14(21)16-13-17-19-20-18-13/h5-9H,1-4H3,(H3,15,16,17,18,19,20,21) |
| InChIKey | WHSBFJDITCJAKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea?
The IUPAC name of 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea (CID 10708495) is 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea.
What is the SMILES notation for 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea?
The canonical SMILES for 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea is CC(C)c1cccc(C(C)C)c1NC(=O)Nc1nn[nH]n1.
What is the InChIKey of 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea?
The InChIKey is WHSBFJDITCJAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6O/c1-8(2)10-6-5-7-11(9(3)4)12(10)15-14(21)16-13-17-19-20-18-13/h5-9H,1-4H3,(H3,15,16,17,18,19,20,21).
What are the key properties of 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea?
1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea has a molecular weight of 288.36 g/mol, XLogP of 3.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-di(propan-2-yl)phenyl]-3-(2H-tetrazol-5-yl)urea is sourced from PubChem (CID 10708495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).