About 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene
2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene (PubChem CID 10708508) has the molecular formula C17H20O2S
and a molecular weight of 288.41 g/mol. Its IUPAC name is 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene.
Molecular Properties
| Compound Name | 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene |
| PubChem CID | 10708508 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene |
| SMILES | COC(/C=C(\C)CSc1ccc2ccccc2c1)OC |
| InChI | InChI=1S/C17H20O2S/c1-13(10-17(18-2)19-3)12-20-16-9-8-14-6-4-5-7-15(14)11-16/h4-11,17H,12H2,1-3H3/b13-10+ |
| InChIKey | KXYMFYCTWBQIPQ-JLHYYAGUSA-N |
| XLogP | 4.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene?
The IUPAC name of 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene (CID 10708508) is 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene.
What is the SMILES notation for 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene?
The canonical SMILES for 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene is COC(/C=C(\C)CSc1ccc2ccccc2c1)OC.
What is the InChIKey of 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene?
The InChIKey is KXYMFYCTWBQIPQ-JLHYYAGUSA-N. The full InChI is InChI=1S/C17H20O2S/c1-13(10-17(18-2)19-3)12-20-16-9-8-14-6-4-5-7-15(14)11-16/h4-11,17H,12H2,1-3H3/b13-10+.
What are the key properties of 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene?
2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene has a molecular weight of 288.41 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanylnaphthalene is sourced from PubChem (CID 10708508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).