About 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine
5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine (PubChem CID 107085159) has the molecular formula C8H10BrF2N3
and a molecular weight of 266.09 g/mol. Its IUPAC name is 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine |
| PubChem CID | 107085159 |
| Molecular Formula | C8H10BrF2N3 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine |
| SMILES | CN(CC(F)F)c1ncc(CBr)cn1 |
| InChI | InChI=1S/C8H10BrF2N3/c1-14(5-7(10)11)8-12-3-6(2-9)4-13-8/h3-4,7H,2,5H2,1H3 |
| InChIKey | LLLGWGJVOOBDKJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine?
The IUPAC name of 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine (CID 107085159) is 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine.
What is the SMILES notation for 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine?
The canonical SMILES for 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine is CN(CC(F)F)c1ncc(CBr)cn1.
What is the InChIKey of 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine?
The InChIKey is LLLGWGJVOOBDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrF2N3/c1-14(5-7(10)11)8-12-3-6(2-9)4-13-8/h3-4,7H,2,5H2,1H3.
What are the key properties of 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine?
5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine has a molecular weight of 266.09 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-N-(2,2-difluoroethyl)-N-methylpyrimidin-2-amine is sourced from PubChem (CID 107085159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).