C14H19BrFN — CID 107085212
1-[2-(bromomethyl)-4-fluorophenyl]-3,4-dimethylpiperidine (PubChem CID 107085212) has the molecular formula C14H19BrFN and a molecular weight of 300.22 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-fluorophenyl]-3,4-dimethylpiperidine.
| Compound Name | 1-[2-(bromomethyl)-4-fluorophenyl]-3,4-dimethylpiperidine |
|---|---|
| PubChem CID | 107085212 |
| Molecular Formula | C14H19BrFN |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-[2-(bromomethyl)-4-fluorophenyl]-3,4-dimethylpiperidine |
| SMILES | CC1CCN(c2ccc(F)cc2CBr)CC1C |
| InChI | InChI=1S/C14H19BrFN/c1-10-5-6-17(9-11(10)2)14-4-3-13(16)7-12(14)8-15/h3-4,7,10-11H,5-6,8-9H2,1-2H3 |
| InChIKey | OPSDLTXOEIKVNG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|