About 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine
4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine (PubChem CID 107085287) has the molecular formula C14H17BrF3NS
and a molecular weight of 368.26 g/mol. Its IUPAC name is 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine |
| PubChem CID | 107085287 |
| Molecular Formula | C14H17BrF3NS |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(c2ccc(CBr)cc2C(F)(F)F)CCS1 |
| InChI | InChI=1S/C14H17BrF3NS/c1-13(2)9-19(5-6-20-13)12-4-3-10(8-15)7-11(12)14(16,17)18/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | PMEJDFHPOQVAFF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine?
The IUPAC name of 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine (CID 107085287) is 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine.
What is the SMILES notation for 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine?
The canonical SMILES for 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine is CC1(C)CN(c2ccc(CBr)cc2C(F)(F)F)CCS1.
What is the InChIKey of 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine?
The InChIKey is PMEJDFHPOQVAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrF3NS/c1-13(2)9-19(5-6-20-13)12-4-3-10(8-15)7-11(12)14(16,17)18/h3-4,7H,5-6,8-9H2,1-2H3.
What are the key properties of 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine?
4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine has a molecular weight of 368.26 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,2-dimethylthiomorpholine is sourced from PubChem (CID 107085287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).