About ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide
ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide (PubChem CID 10708597) has the molecular formula C12H20BrNO2
and a molecular weight of 290.20 g/mol. Its IUPAC name is ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide.
Molecular Properties
| Compound Name | ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide |
| PubChem CID | 10708597 |
| Molecular Formula | C12H20BrNO2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide |
| SMILES | C=CC[N+]1(C)CC=C(C(=O)OCC)CC1.[Br-] |
| InChI | InChI=1S/C12H20NO2.BrH/c1-4-8-13(3)9-6-11(7-10-13)12(14)15-5-2;/h4,6H,1,5,7-10H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | UVZVICGYUSVKCA-UHFFFAOYSA-M |
| XLogP | -1.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide?
The IUPAC name of ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide (CID 10708597) is ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide.
What is the SMILES notation for ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide?
The canonical SMILES for ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide is C=CC[N+]1(C)CC=C(C(=O)OCC)CC1.[Br-].
What is the InChIKey of ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide?
The InChIKey is UVZVICGYUSVKCA-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H20NO2.BrH/c1-4-8-13(3)9-6-11(7-10-13)12(14)15-5-2;/h4,6H,1,5,7-10H2,2-3H3;1H/q+1;/p-1.
What are the key properties of ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide?
ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide has a molecular weight of 290.20 g/mol, XLogP of -1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium-4-carboxylate bromide is sourced from PubChem (CID 10708597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).