C19H14O3 — CID 10708613
(3S,7R)-4,6-dioxapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),11,14,16,18,20-heptaen-5-one (PubChem CID 10708613) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is (3S,7R)-4,6-dioxapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),11,14,16,18,20-heptaen-5-one.
| Compound Name | (3S,7R)-4,6-dioxapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),11,14,16,18,20-heptaen-5-one |
|---|---|
| PubChem CID | 10708613 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (3S,7R)-4,6-dioxapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),11,14,16,18,20-heptaen-5-one |
| SMILES | O=C1O[C@@H]2CCc3ccc4c(ccc5ccccc54)c3[C@@H]2O1 |
| InChI | InChI=1S/C19H14O3/c20-19-21-16-10-7-12-6-8-14-13-4-2-1-3-11(13)5-9-15(14)17(12)18(16)22-19/h1-6,8-9,16,18H,7,10H2/t16-,18-/m1/s1 |
| InChIKey | KUNXBAWAVQCBBG-SJLPKXTDSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|