C17H22O2S — CID 10708646
(2S,4R)-4-prop-1-en-2-yl-15lambda6-thiatricyclo[8.4.1.02,7]pentadeca-7,11,13-triene 15,15-dioxide (PubChem CID 10708646) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is (2S,4R)-4-prop-1-en-2-yl-15lambda6-thiatricyclo[8.4.1.02,7]pentadeca-7,11,13-triene 15,15-dioxide.
| Compound Name | (2S,4R)-4-prop-1-en-2-yl-15lambda6-thiatricyclo[8.4.1.02,7]pentadeca-7,11,13-triene 15,15-dioxide |
|---|---|
| PubChem CID | 10708646 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S,4R)-4-prop-1-en-2-yl-15lambda6-thiatricyclo[8.4.1.02,7]pentadeca-7,11,13-triene 15,15-dioxide |
| SMILES | C=C(C)[C@@H]1CCC2=CCC3C=CC=CC([C@H]2C1)S3(=O)=O |
| InChI | InChI=1S/C17H22O2S/c1-12(2)14-8-7-13-9-10-15-5-3-4-6-17(16(13)11-14)20(15,18)19/h3-6,9,14-17H,1,7-8,10-11H2,2H3/t14-,15?,16+,17?/m1/s1 |
| InChIKey | IRXRUXCISSQCMR-GYXIZQIFSA-N |
| XLogP | 3.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|