C12H12BrIN2O — CID 107087513
4-(bromomethyl)-5-(4-iodophenoxy)-1,3-dimethylpyrazole (PubChem CID 107087513) has the molecular formula C12H12BrIN2O and a molecular weight of 407.05 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(4-iodophenoxy)-1,3-dimethylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(4-iodophenoxy)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 107087513 |
| Molecular Formula | C12H12BrIN2O |
| Molecular Weight | 407.05 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 4-(bromomethyl)-5-(4-iodophenoxy)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Oc2ccc(I)cc2)c1CBr |
| InChI | InChI=1S/C12H12BrIN2O/c1-8-11(7-13)12(16(2)15-8)17-10-5-3-9(14)4-6-10/h3-6H,7H2,1-2H3 |
| InChIKey | WYAVFFZDJYGKJC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|