C12H11BrF2N2O — CID 107087762
4-(bromomethyl)-5-(3,4-difluorophenoxy)-1,3-dimethylpyrazole (PubChem CID 107087762) has the molecular formula C12H11BrF2N2O and a molecular weight of 317.13 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(3,4-difluorophenoxy)-1,3-dimethylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(3,4-difluorophenoxy)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 107087762 |
| Molecular Formula | C12H11BrF2N2O |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 4-(bromomethyl)-5-(3,4-difluorophenoxy)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Oc2ccc(F)c(F)c2)c1CBr |
| InChI | InChI=1S/C12H11BrF2N2O/c1-7-9(6-13)12(17(2)16-7)18-8-3-4-10(14)11(15)5-8/h3-5H,6H2,1-2H3 |
| InChIKey | DBPLOGYITXWEEZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|