C11H6Cl4N2O — CID 107087892
4-chloro-5-(chloromethyl)-6-(3,4-dichlorophenoxy)pyrimidine (PubChem CID 107087892) has the molecular formula C11H6Cl4N2O and a molecular weight of 323.99 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-6-(3,4-dichlorophenoxy)pyrimidine.
| Compound Name | 4-chloro-5-(chloromethyl)-6-(3,4-dichlorophenoxy)pyrimidine |
|---|---|
| PubChem CID | 107087892 |
| Molecular Formula | C11H6Cl4N2O |
| Molecular Weight | 323.99 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-6-(3,4-dichlorophenoxy)pyrimidine |
| SMILES | ClCc1c(Cl)ncnc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl4N2O/c12-4-7-10(15)16-5-17-11(7)18-6-1-2-8(13)9(14)3-6/h1-3,5H,4H2 |
| InChIKey | YSWOLZRBMYLHGE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|