About (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine
(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine (PubChem CID 10708799) has the molecular formula C19H20N2O
and a molecular weight of 292.38 g/mol. Its IUPAC name is (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine.
Molecular Properties
| Compound Name | (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine |
| PubChem CID | 10708799 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine |
| SMILES | C[C@H](N/C(=C\C1=NCCO1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O/c1-15(16-8-4-2-5-9-16)21-18(14-19-20-12-13-22-19)17-10-6-3-7-11-17/h2-11,14-15,21H,12-13H2,1H3/b18-14-/t15-/m0/s1 |
| InChIKey | VKDYXIHXAROXQF-LSVCFVEQSA-N |
| XLogP | 3.81 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine?
The IUPAC name of (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine (CID 10708799) is (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine.
What is the SMILES notation for (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine?
The canonical SMILES for (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine is C[C@H](N/C(=C\C1=NCCO1)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine?
The InChIKey is VKDYXIHXAROXQF-LSVCFVEQSA-N. The full InChI is InChI=1S/C19H20N2O/c1-15(16-8-4-2-5-9-16)21-18(14-19-20-12-13-22-19)17-10-6-3-7-11-17/h2-11,14-15,21H,12-13H2,1H3/b18-14-/t15-/m0/s1.
What are the key properties of (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine?
(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine has a molecular weight of 292.38 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenyl-N-[(1S)-1-phenylethyl]ethenamine is sourced from PubChem (CID 10708799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).