About 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole
3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole (PubChem CID 10708935) has the molecular formula C19H19FN2
and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole.
Molecular Properties
| Compound Name | 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole |
| PubChem CID | 10708935 |
| Molecular Formula | C19H19FN2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole |
| SMILES | F[C@@H]1CCNC[C@H]1c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H19FN2/c20-16-10-11-21-12-15(16)18-14-8-4-5-9-17(14)22-19(18)13-6-2-1-3-7-13/h1-9,15-16,21-22H,10-12H2/t15-,16-/m1/s1 |
| InChIKey | QAMSRCBRYCCTDQ-HZPDHXFCSA-N |
| XLogP | 4.25 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
The IUPAC name of 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole (CID 10708935) is 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole.
What is the SMILES notation for 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
The canonical SMILES for 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole is F[C@@H]1CCNC[C@H]1c1c(-c2ccccc2)[nH]c2ccccc12.
What is the InChIKey of 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
The InChIKey is QAMSRCBRYCCTDQ-HZPDHXFCSA-N. The full InChI is InChI=1S/C19H19FN2/c20-16-10-11-21-12-15(16)18-14-8-4-5-9-17(14)22-19(18)13-6-2-1-3-7-13/h1-9,15-16,21-22H,10-12H2/t15-,16-/m1/s1.
What are the key properties of 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole has a molecular weight of 294.37 g/mol, XLogP of 4.25, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole is sourced from PubChem (CID 10708935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).