C19H30O2 — CID 10708959
(8R,9S,10S,13S,14S,17S)-3,3,7,7-tetradeuterio-10-(hydroxymethyl)-13-methyl-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 10708959) has the molecular formula C19H30O2 and a molecular weight of 294.47 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17S)-3,3,7,7-tetradeuterio-10-(hydroxymethyl)-13-methyl-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10S,13S,14S,17S)-3,3,7,7-tetradeuterio-10-(hydroxymethyl)-13-methyl-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 10708959 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | (8R,9S,10S,13S,14S,17S)-3,3,7,7-tetradeuterio-10-(hydroxymethyl)-13-methyl-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | [2H]C1([2H])C=C2CC([2H])([2H])[C@@H]3[C@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)[C@@]2(CO)CC1 |
| InChI | InChI=1S/C19H30O2/c1-18-11-9-16-14(15(18)7-8-17(18)21)6-5-13-4-2-3-10-19(13,16)12-20/h4,14-17,20-21H,2-3,5-12H2,1H3/t14-,15-,16-,17-,18-,19+/m0/s1/i2D2,6D2 |
| InChIKey | WEXKAORQQXRDCM-VXRLXPLRSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|