C17H28O4 — CID 10709065
(3E,5R,8S,9E,13S,14R)-5,8-dihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,9-dien-2-one (PubChem CID 10709065) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3E,5R,8S,9E,13S,14R)-5,8-dihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,9-dien-2-one.
| Compound Name | (3E,5R,8S,9E,13S,14R)-5,8-dihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,9-dien-2-one |
|---|---|
| PubChem CID | 10709065 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (3E,5R,8S,9E,13S,14R)-5,8-dihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,9-dien-2-one |
| SMILES | C/C1=C\CC[C@H](C)[C@@H](C)OC(=O)/C=C/[C@](C)(O)CC[C@@H]1O |
| InChI | InChI=1S/C17H28O4/c1-12-6-5-7-13(2)15(18)8-10-17(4,20)11-9-16(19)21-14(12)3/h7,9,11-12,14-15,18,20H,5-6,8,10H2,1-4H3/b11-9+,13-7+/t12-,14+,15-,17+/m0/s1 |
| InChIKey | IDGNDQYOCKRQMV-WMZCOYIESA-N |
| XLogP | 2.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|