About N,2-dibenzyl-N'-hydroxypropanediamide
N,2-dibenzyl-N'-hydroxypropanediamide (PubChem CID 10709191) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is N,2-dibenzyl-N'-hydroxypropanediamide.
Molecular Properties
| Compound Name | N,2-dibenzyl-N'-hydroxypropanediamide |
| PubChem CID | 10709191 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N,2-dibenzyl-N'-hydroxypropanediamide |
| SMILES | O=C(NO)C(Cc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c20-16(18-12-14-9-5-2-6-10-14)15(17(21)19-22)11-13-7-3-1-4-8-13/h1-10,15,22H,11-12H2,(H,18,20)(H,19,21) |
| InChIKey | WKIMWNKNDQXNCK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,2-dibenzyl-N'-hydroxypropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dibenzyl-N'-hydroxypropanediamide?
The IUPAC name of N,2-dibenzyl-N'-hydroxypropanediamide (CID 10709191) is N,2-dibenzyl-N'-hydroxypropanediamide.
What is the SMILES notation for N,2-dibenzyl-N'-hydroxypropanediamide?
The canonical SMILES for N,2-dibenzyl-N'-hydroxypropanediamide is O=C(NO)C(Cc1ccccc1)C(=O)NCc1ccccc1.
What is the InChIKey of N,2-dibenzyl-N'-hydroxypropanediamide?
The InChIKey is WKIMWNKNDQXNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c20-16(18-12-14-9-5-2-6-10-14)15(17(21)19-22)11-13-7-3-1-4-8-13/h1-10,15,22H,11-12H2,(H,18,20)(H,19,21).
What are the key properties of N,2-dibenzyl-N'-hydroxypropanediamide?
N,2-dibenzyl-N'-hydroxypropanediamide has a molecular weight of 298.34 g/mol, XLogP of 1.67, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dibenzyl-N'-hydroxypropanediamide is sourced from PubChem (CID 10709191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).