C18H18O2S — CID 10709214
(4S,5R)-2,2-dimethyl-5-phenyl-4-phenylsulfanyloxolan-3-one (PubChem CID 10709214) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is (4S,5R)-2,2-dimethyl-5-phenyl-4-phenylsulfanyloxolan-3-one.
| Compound Name | (4S,5R)-2,2-dimethyl-5-phenyl-4-phenylsulfanyloxolan-3-one |
|---|---|
| PubChem CID | 10709214 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (4S,5R)-2,2-dimethyl-5-phenyl-4-phenylsulfanyloxolan-3-one |
| SMILES | CC1(C)O[C@H](c2ccccc2)[C@H](Sc2ccccc2)C1=O |
| InChI | InChI=1S/C18H18O2S/c1-18(2)17(19)16(21-14-11-7-4-8-12-14)15(20-18)13-9-5-3-6-10-13/h3-12,15-16H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | QOCAVUBVVOJKJY-CVEARBPZSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |