C17H18N2OS — CID 10709216
3-benzyl-2-butylthieno[3,2-d]pyrimidin-4-one (PubChem CID 10709216) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-benzyl-2-butylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-2-butylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10709216 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-benzyl-2-butylthieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCCc1nc2ccsc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2OS/c1-2-3-9-15-18-14-10-11-21-16(14)17(20)19(15)12-13-7-5-4-6-8-13/h4-8,10-11H,2-3,9,12H2,1H3 |
| InChIKey | YBGLUEMHERYXLN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |