C14H29N3O4S — CID 107093119
tert-butyl 3-(1-hydrazinyl-4-methylsulfonylbutyl)pyrrolidine-1-carboxylate (PubChem CID 107093119) has the molecular formula C14H29N3O4S and a molecular weight of 335.47 g/mol. Its IUPAC name is tert-butyl 3-(1-hydrazinyl-4-methylsulfonylbutyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1-hydrazinyl-4-methylsulfonylbutyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107093119 |
| Molecular Formula | C14H29N3O4S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | tert-butyl 3-(1-hydrazinyl-4-methylsulfonylbutyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CCCS(C)(=O)=O)NN)C1 |
| InChI | InChI=1S/C14H29N3O4S/c1-14(2,3)21-13(18)17-8-7-11(10-17)12(16-15)6-5-9-22(4,19)20/h11-12,16H,5-10,15H2,1-4H3 |
| InChIKey | JMHKGZSKYQWXDP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|