C19H24O3 — CID 10709364
(1S,4S,6S,10R,14E)-4-methyl-9-methylidene-14-penta-3,4-dienylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one (PubChem CID 10709364) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1S,4S,6S,10R,14E)-4-methyl-9-methylidene-14-penta-3,4-dienylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one.
| Compound Name | (1S,4S,6S,10R,14E)-4-methyl-9-methylidene-14-penta-3,4-dienylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one |
|---|---|
| PubChem CID | 10709364 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (1S,4S,6S,10R,14E)-4-methyl-9-methylidene-14-penta-3,4-dienylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one |
| SMILES | C=C=CC/C=C1/C(=O)OC[C@H]2C(=C)CC[C@@H]3O[C@@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C19H24O3/c1-4-5-6-7-15-14-10-11-19(3)17(22-19)9-8-13(2)16(14)12-21-18(15)20/h5,7,14,16-17H,1-2,6,8-12H2,3H3/b15-7+/t14-,16+,17+,19+/m1/s1 |
| InChIKey | DNLGLROXRPVTKW-YNRFNGFMSA-N |
| XLogP | 3.72 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|