C15H31NO3Si — CID 10709453
5-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl]-1,3-oxazolidin-2-one (PubChem CID 10709453) has the molecular formula C15H31NO3Si and a molecular weight of 301.50 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10709453 |
| Molecular Formula | C15H31NO3Si |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(CCC1CNC(=O)O1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H31NO3Si/c1-14(2,3)20(6,7)18-11-15(4,5)9-8-12-10-16-13(17)19-12/h12H,8-11H2,1-7H3,(H,16,17) |
| InChIKey | KYWSVVZXVRYGJT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|