C14H18N4O3 — CID 107094551
6-nitro-N-[2-(oxan-2-yl)ethyl]-1H-benzimidazol-2-amine (PubChem CID 107094551) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 6-nitro-N-[2-(oxan-2-yl)ethyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-nitro-N-[2-(oxan-2-yl)ethyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 107094551 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 6-nitro-N-[2-(oxan-2-yl)ethyl]-1H-benzimidazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCCC3CCCCO3)[nH]c2c1 |
| InChI | InChI=1S/C14H18N4O3/c19-18(20)10-4-5-12-13(9-10)17-14(16-12)15-7-6-11-3-1-2-8-21-11/h4-5,9,11H,1-3,6-8H2,(H2,15,16,17) |
| InChIKey | LSSADVSMVSNXPV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|