C10H20N2O3S — CID 107094808
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N-ethylethanesulfonamide (PubChem CID 107094808) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N-ethylethanesulfonamide.
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 107094808 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNCC1CCC=CO1 |
| InChI | InChI=1S/C10H20N2O3S/c1-2-12-16(13,14)8-6-11-9-10-5-3-4-7-15-10/h4,7,10-12H,2-3,5-6,8-9H2,1H3 |
| InChIKey | VQNPJJYWTVMQRI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|