C15H28N2O3 — CID 107094890
tert-butyl N-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)butan-2-yl]carbamate (PubChem CID 107094890) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl N-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107094890 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl N-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)butan-2-yl]carbamate |
| SMILES | CC(CCNCC1CCC=CO1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-12(17-14(18)20-15(2,3)4)8-9-16-11-13-7-5-6-10-19-13/h6,10,12-13,16H,5,7-9,11H2,1-4H3,(H,17,18) |
| InChIKey | KRMWRINYJFYOTN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|