C8H16N2O — CID 107095554
2-[(1-methylcyclobutyl)methylamino]acetamide (PubChem CID 107095554) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-[(1-methylcyclobutyl)methylamino]acetamide.
| Compound Name | 2-[(1-methylcyclobutyl)methylamino]acetamide |
|---|---|
| PubChem CID | 107095554 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-[(1-methylcyclobutyl)methylamino]acetamide |
| SMILES | CC1(CNCC(N)=O)CCC1 |
| InChI | InChI=1S/C8H16N2O/c1-8(3-2-4-8)6-10-5-7(9)11/h10H,2-6H2,1H3,(H2,9,11) |
| InChIKey | NTMANNZLLHZYMP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |