C11H19F4N — CID 107095611
2,4,4-trimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine (PubChem CID 107095611) has the molecular formula C11H19F4N and a molecular weight of 241.27 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine.
| Compound Name | 2,4,4-trimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 107095611 |
| Molecular Formula | C11H19F4N |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2,4,4-trimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine |
| SMILES | CC1CC(C)(C)CC1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H19F4N/c1-7-4-10(2,3)5-8(7)16-6-11(14,15)9(12)13/h7-9,16H,4-6H2,1-3H3 |
| InChIKey | ZCBZAEIIZIFBRU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|