About 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one
6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one (PubChem CID 10709595) has the molecular formula C14H10BrNO2
and a molecular weight of 304.14 g/mol. Its IUPAC name is 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one |
| PubChem CID | 10709595 |
| Molecular Formula | C14H10BrNO2 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccccn2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H10BrNO2/c15-9-4-5-13-10(7-9)12(17)8-14(18-13)11-3-1-2-6-16-11/h1-7,14H,8H2 |
| InChIKey | QFZZQUZYNXDRTE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one?
The IUPAC name of 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one (CID 10709595) is 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one is O=C1CC(c2ccccn2)Oc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one?
The InChIKey is QFZZQUZYNXDRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrNO2/c15-9-4-5-13-10(7-9)12(17)8-14(18-13)11-3-1-2-6-16-11/h1-7,14H,8H2.
What are the key properties of 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one?
6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one has a molecular weight of 304.14 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-pyridin-2-yl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 10709595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).