About CID 10709600
CID 10709600 (PubChem CID 10709600) has the molecular formula C10H15OS
and a molecular weight of 183.30 g/mol.
Molecular Properties
| Compound Name | CID 10709600 |
| PubChem CID | 10709600 |
| Molecular Formula | C10H15OS |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | — |
| SMILES | CC(C)(C)S[C]1[CH][CH][CH][C]1CO |
| InChI | InChI=1S/C10H15OS/c1-10(2,3)12-9-6-4-5-8(9)7-11/h4-6,11H,7H2,1-3H3 |
| InChIKey | BMNOJBYLPPCYDI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 10709600 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10709600?
The IUPAC name of CID 10709600 (CID 10709600) is not available.
What is the SMILES notation for CID 10709600?
The canonical SMILES for CID 10709600 is CC(C)(C)S[C]1[CH][CH][CH][C]1CO.
What is the InChIKey of CID 10709600?
The InChIKey is BMNOJBYLPPCYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15OS/c1-10(2,3)12-9-6-4-5-8(9)7-11/h4-6,11H,7H2,1-3H3.
What are the key properties of CID 10709600?
CID 10709600 has a molecular weight of 183.30 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10709600 is sourced from PubChem (CID 10709600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).