C14H29CuOSi — CID 10709684
tert-butyl-dimethyl-[(3S)-oct-1-en-3-yl]oxysilane;copper(1+) (PubChem CID 10709684) has the molecular formula C14H29CuOSi and a molecular weight of 305.02 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S)-oct-1-en-3-yl]oxysilane;copper(1+).
| Compound Name | tert-butyl-dimethyl-[(3S)-oct-1-en-3-yl]oxysilane;copper(1+) |
|---|---|
| PubChem CID | 10709684 |
| Molecular Formula | C14H29CuOSi |
| Molecular Weight | 305.02 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | tert-butyl-dimethyl-[(3S)-oct-1-en-3-yl]oxysilane;copper(1+) |
| SMILES | [Cu+].[H]/[C-]=C\[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29OSi.Cu/c1-8-10-11-12-13(9-2)15-16(6,7)14(3,4)5;/h2,9,13H,8,10-12H2,1,3-7H3;/q-1;+1/t13-;/m1./s1 |
| InChIKey | AELQBNMAOILCFC-BTQNPOSSSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.02 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|