About [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine
[2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine (PubChem CID 107097304) has the molecular formula C15H13BrF2N2O
and a molecular weight of 355.18 g/mol. Its IUPAC name is [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine |
| PubChem CID | 107097304 |
| Molecular Formula | C15H13BrF2N2O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine |
| SMILES | NCc1cc2c(nc1Oc1cc(Br)cc(F)c1F)CCC2 |
| InChI | InChI=1S/C15H13BrF2N2O/c16-10-5-11(17)14(18)13(6-10)21-15-9(7-19)4-8-2-1-3-12(8)20-15/h4-6H,1-3,7,19H2 |
| InChIKey | RJMVSSHYXPQALN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine?
The IUPAC name of [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine (CID 107097304) is [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine.
What is the SMILES notation for [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine?
The canonical SMILES for [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine is NCc1cc2c(nc1Oc1cc(Br)cc(F)c1F)CCC2.
What is the InChIKey of [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine?
The InChIKey is RJMVSSHYXPQALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrF2N2O/c16-10-5-11(17)14(18)13(6-10)21-15-9(7-19)4-8-2-1-3-12(8)20-15/h4-6H,1-3,7,19H2.
What are the key properties of [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine?
[2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine has a molecular weight of 355.18 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-bromo-2,3-difluorophenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]methanamine is sourced from PubChem (CID 107097304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).