About 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid
6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid (PubChem CID 10709846) has the molecular formula C11H19N2O5P
and a molecular weight of 290.26 g/mol. Its IUPAC name is 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid.
Molecular Properties
| Compound Name | 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid |
| PubChem CID | 10709846 |
| Molecular Formula | C11H19N2O5P |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid |
| SMILES | Cc1cn(CCCCCCP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H19N2O5P/c1-9-8-13(11(15)12-10(9)14)6-4-2-3-5-7-19(16,17)18/h8H,2-7H2,1H3,(H,12,14,15)(H2,16,17,18) |
| InChIKey | SXJHSWBYPAEGQE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid?
The IUPAC name of 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid (CID 10709846) is 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid.
What is the SMILES notation for 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid?
The canonical SMILES for 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid is Cc1cn(CCCCCCP(=O)(O)O)c(=O)[nH]c1=O.
What is the InChIKey of 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid?
The InChIKey is SXJHSWBYPAEGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2O5P/c1-9-8-13(11(15)12-10(9)14)6-4-2-3-5-7-19(16,17)18/h8H,2-7H2,1H3,(H,12,14,15)(H2,16,17,18).
What are the key properties of 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid?
6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid has a molecular weight of 290.26 g/mol, XLogP of 0.58, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-methyl-2,4-dioxopyrimidin-1-yl)hexylphosphonic acid is sourced from PubChem (CID 10709846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).