C13H7BrClF3O — CID 107098749
5-bromo-1-[(3-chloro-2-fluorophenyl)methoxy]-2,3-difluorobenzene (PubChem CID 107098749) has the molecular formula C13H7BrClF3O and a molecular weight of 351.55 g/mol. Its IUPAC name is 5-bromo-1-[(3-chloro-2-fluorophenyl)methoxy]-2,3-difluorobenzene.
| Compound Name | 5-bromo-1-[(3-chloro-2-fluorophenyl)methoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 107098749 |
| Molecular Formula | C13H7BrClF3O |
| Molecular Weight | 351.55 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 5-bromo-1-[(3-chloro-2-fluorophenyl)methoxy]-2,3-difluorobenzene |
| SMILES | Fc1cc(Br)cc(OCc2cccc(Cl)c2F)c1F |
| InChI | InChI=1S/C13H7BrClF3O/c14-8-4-10(16)13(18)11(5-8)19-6-7-2-1-3-9(15)12(7)17/h1-5H,6H2 |
| InChIKey | QNMVCHARVYPFSA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|