About (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid
(E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid (PubChem CID 10709955) has the molecular formula C17H24O3S
and a molecular weight of 308.44 g/mol. Its IUPAC name is (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid.
Molecular Properties
| Compound Name | (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid |
| PubChem CID | 10709955 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid |
| SMILES | COc1c(C/C=C(\C)CCC(=O)O)cc(SC)c(C)c1C |
| InChI | InChI=1S/C17H24O3S/c1-11(7-9-16(18)19)6-8-14-10-15(21-5)12(2)13(3)17(14)20-4/h6,10H,7-9H2,1-5H3,(H,18,19)/b11-6+ |
| InChIKey | ILUSTSUREMFZQM-IZZDOVSWSA-N |
| XLogP | 4.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid?
The IUPAC name of (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid (CID 10709955) is (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid.
What is the SMILES notation for (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid?
The canonical SMILES for (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid is COc1c(C/C=C(\C)CCC(=O)O)cc(SC)c(C)c1C.
What is the InChIKey of (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid?
The InChIKey is ILUSTSUREMFZQM-IZZDOVSWSA-N. The full InChI is InChI=1S/C17H24O3S/c1-11(7-9-16(18)19)6-8-14-10-15(21-5)12(2)13(3)17(14)20-4/h6,10H,7-9H2,1-5H3,(H,18,19)/b11-6+.
What are the key properties of (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid?
(E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid has a molecular weight of 308.44 g/mol, XLogP of 4.39, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-(2-methoxy-3,4-dimethyl-5-methylsulfanylphenyl)-4-methylhex-4-enoic acid is sourced from PubChem (CID 10709955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).