C16H24O4Si — CID 10709958
(1R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-6,11-dioxatricyclo[7.2.1.04,10]dodeca-3,9(12)-dien-5-one (PubChem CID 10709958) has the molecular formula C16H24O4Si and a molecular weight of 308.45 g/mol. Its IUPAC name is (1R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-6,11-dioxatricyclo[7.2.1.04,10]dodeca-3,9(12)-dien-5-one.
| Compound Name | (1R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-6,11-dioxatricyclo[7.2.1.04,10]dodeca-3,9(12)-dien-5-one |
|---|---|
| PubChem CID | 10709958 |
| Molecular Formula | C16H24O4Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-6,11-dioxatricyclo[7.2.1.04,10]dodeca-3,9(12)-dien-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2C(=O)OCCC3=C[C@@H](C1)O[C@H]32 |
| InChI | InChI=1S/C16H24O4Si/c1-16(2,3)21(4,5)20-12-9-11-8-10-6-7-18-15(17)13(12)14(10)19-11/h8,11,14H,6-7,9H2,1-5H3/t11-,14+/m0/s1 |
| InChIKey | JOSYDNHGGDKVMV-SMDDNHRTSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|