C13H17BrClNO — CID 107100236
N-(1-bromo-2-methylpropan-2-yl)-3-chloro-N,2-dimethylbenzamide (PubChem CID 107100236) has the molecular formula C13H17BrClNO and a molecular weight of 318.64 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-3-chloro-N,2-dimethylbenzamide.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-3-chloro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 107100236 |
| Molecular Formula | C13H17BrClNO |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-3-chloro-N,2-dimethylbenzamide |
| SMILES | Cc1c(Cl)cccc1C(=O)N(C)C(C)(C)CBr |
| InChI | InChI=1S/C13H17BrClNO/c1-9-10(6-5-7-11(9)15)12(17)16(4)13(2,3)8-14/h5-7H,8H2,1-4H3 |
| InChIKey | ZUHAINJYFCBFAY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|