C17H26O5 — CID 10710089
(3E,5R,6E,8S,9E,13S,14R)-5,8-dihydroxy-9-(hydroxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one (PubChem CID 10710089) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (3E,5R,6E,8S,9E,13S,14R)-5,8-dihydroxy-9-(hydroxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one.
| Compound Name | (3E,5R,6E,8S,9E,13S,14R)-5,8-dihydroxy-9-(hydroxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one |
|---|---|
| PubChem CID | 10710089 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (3E,5R,6E,8S,9E,13S,14R)-5,8-dihydroxy-9-(hydroxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one |
| SMILES | C[C@H]1CC/C=C(\CO)[C@@H](O)/C=C/[C@@](C)(O)/C=C/C(=O)O[C@@H]1C |
| InChI | InChI=1S/C17H26O5/c1-12-5-4-6-14(11-18)15(19)7-9-17(3,21)10-8-16(20)22-13(12)2/h6-10,12-13,15,18-19,21H,4-5,11H2,1-3H3/b9-7+,10-8+,14-6+/t12-,13+,15-,17+/m0/s1 |
| InChIKey | FIUBGCOVROHRBS-LOJAMSFOSA-N |
| XLogP | 1.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|