About (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone (PubChem CID 10710181) has the molecular formula C20H25NO2
and a molecular weight of 311.43 g/mol. Its IUPAC name is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone |
| PubChem CID | 10710181 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone |
| SMILES | Cn1cccc1C(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C20H25NO2/c1-19(2,3)14-10-13(17(22)16-8-7-9-21(16)6)11-15-18(14)23-12-20(15,4)5/h7-11H,12H2,1-6H3 |
| InChIKey | ZAEMKGJZZJJJLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone?
The IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone (CID 10710181) is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone.
What is the SMILES notation for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone?
The canonical SMILES for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone is Cn1cccc1C(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2.
What is the InChIKey of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone?
The InChIKey is ZAEMKGJZZJJJLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2/c1-19(2,3)14-10-13(17(22)16-8-7-9-21(16)6)11-15-18(14)23-12-20(15,4)5/h7-11H,12H2,1-6H3.
What are the key properties of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone?
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone has a molecular weight of 311.43 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1-methylpyrrol-2-yl)methanone is sourced from PubChem (CID 10710181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).