C14H17BrClN3O — CID 107103101
[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-chloro-2-methylphenyl)methanamine (PubChem CID 107103101) has the molecular formula C14H17BrClN3O and a molecular weight of 358.67 g/mol. Its IUPAC name is [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-chloro-2-methylphenyl)methanamine.
| Compound Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-chloro-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 107103101 |
| Molecular Formula | C14H17BrClN3O |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(3-chloro-2-methylphenyl)methanamine |
| SMILES | COCCn1ncc(Br)c1C(N)c1cccc(Cl)c1C |
| InChI | InChI=1S/C14H17BrClN3O/c1-9-10(4-3-5-12(9)16)13(17)14-11(15)8-18-19(14)6-7-20-2/h3-5,8,13H,6-7,17H2,1-2H3 |
| InChIKey | XNCSWSCGNQIUMA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |