C23H23N — CID 10710333
2,5,6-trimethyl-1,3-diphenyl-4,7-dihydroisoindole (PubChem CID 10710333) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is 2,5,6-trimethyl-1,3-diphenyl-4,7-dihydroisoindole.
| Compound Name | 2,5,6-trimethyl-1,3-diphenyl-4,7-dihydroisoindole |
|---|---|
| PubChem CID | 10710333 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2,5,6-trimethyl-1,3-diphenyl-4,7-dihydroisoindole |
| SMILES | CC1=C(C)Cc2c(c(-c3ccccc3)n(C)c2-c2ccccc2)C1 |
| InChI | InChI=1S/C23H23N/c1-16-14-20-21(15-17(16)2)23(19-12-8-5-9-13-19)24(3)22(20)18-10-6-4-7-11-18/h4-13H,14-15H2,1-3H3 |
| InChIKey | ACNHZSWLZCKIAM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|