C11H5F7N2O — CID 10710351
2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 10710351) has the molecular formula C11H5F7N2O and a molecular weight of 314.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 10710351 |
| Molecular Formula | C11H5F7N2O |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C11H5F7N2O/c12-9(13,10(14,15)11(16,17)18)6-5-8(21)20-4-2-1-3-7(20)19-6/h1-5H |
| InChIKey | UWNGERPPLIUOAC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|