C20H26O3 — CID 10710388
(6R,8R,9S,10R,13S,14S)-6-methoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10710388) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is (6R,8R,9S,10R,13S,14S)-6-methoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10R,13S,14S)-6-methoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10710388 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (6R,8R,9S,10R,13S,14S)-6-methoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CO[C@@H]1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C20H26O3/c1-19-8-6-12(21)10-16(19)17(23-3)11-13-14-4-5-18(22)20(14,2)9-7-15(13)19/h6,8,10,13-15,17H,4-5,7,9,11H2,1-3H3/t13-,14-,15-,17+,19+,20-/m0/s1 |
| InChIKey | DMKRZIKUGNDODB-XOJMLDNQSA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |