C13H15BrO4 — CID 10710413
(1aS,7bS)-6-bromo-2,2-bis(methoxymethyl)-1a,7b-dihydrooxireno[2,3-c]chromene (PubChem CID 10710413) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is (1aS,7bS)-6-bromo-2,2-bis(methoxymethyl)-1a,7b-dihydrooxireno[2,3-c]chromene.
| Compound Name | (1aS,7bS)-6-bromo-2,2-bis(methoxymethyl)-1a,7b-dihydrooxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 10710413 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (1aS,7bS)-6-bromo-2,2-bis(methoxymethyl)-1a,7b-dihydrooxireno[2,3-c]chromene |
| SMILES | COCC1(COC)Oc2ccc(Br)cc2[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C13H15BrO4/c1-15-6-13(7-16-2)12-11(17-12)9-5-8(14)3-4-10(9)18-13/h3-5,11-12H,6-7H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | NZVVXTBYQMOKAD-RYUDHWBXSA-N |
| XLogP | 2.31 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|